C26H26Cl2N4O — CID 59238971
2-[(2,10-dichloro-12-pyrrolidin-1-yl-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]-N,N-dimethylethanamine (PubChem CID 59238971) has the molecular formula C26H26Cl2N4O and a molecular weight of 481.43 g/mol. Its IUPAC name is 2-[(2,10-dichloro-12-pyrrolidin-1-yl-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]-N,N-dimethylethanamine.
| Compound Name | 2-[(2,10-dichloro-12-pyrrolidin-1-yl-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 59238971 |
| Molecular Formula | C26H26Cl2N4O |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-[(2,10-dichloro-12-pyrrolidin-1-yl-5,7-dihydroindolo[2,3-b]carbazol-6-yl)oxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1c2[nH]c3ccc(Cl)cc3c2c(N2CCCC2)c2c1[nH]c1ccc(Cl)cc12 |
| InChI | InChI=1S/C26H26Cl2N4O/c1-31(2)11-12-33-26-23-21(17-13-15(27)5-7-19(17)29-23)25(32-9-3-4-10-32)22-18-14-16(28)6-8-20(18)30-24(22)26/h5-8,13-14,29-30H,3-4,9-12H2,1-2H3 |
| InChIKey | PXMRSGRVAZSVJQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|