C28H32N8O3 — CID 59239603
3-(ethylamino)-4-[4-[4-[(3S)-3-methylmorpholin-4-yl]-7-pyrimidin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]anilino]cyclobutane-1,2-dione (PubChem CID 59239603) has the molecular formula C28H32N8O3 and a molecular weight of 528.62 g/mol. Its IUPAC name is 3-(ethylamino)-4-[4-[4-[(3S)-3-methylmorpholin-4-yl]-7-pyrimidin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]anilino]cyclobutane-1,2-dione.
| Compound Name | 3-(ethylamino)-4-[4-[4-[(3S)-3-methylmorpholin-4-yl]-7-pyrimidin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]anilino]cyclobutane-1,2-dione |
|---|---|
| PubChem CID | 59239603 |
| Molecular Formula | C28H32N8O3 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 3-(ethylamino)-4-[4-[4-[(3S)-3-methylmorpholin-4-yl]-7-pyrimidin-2-yl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-yl]anilino]cyclobutane-1,2-dione |
| SMILES | CCNC1C(=O)C(=O)C1Nc1ccc(-c2nc3c(c(N4CCOC[C@@H]4C)n2)CCN(c2ncccn2)C3)cc1 |
| InChI | InChI=1S/C28H32N8O3/c1-3-29-22-23(25(38)24(22)37)32-19-7-5-18(6-8-19)26-33-21-15-35(28-30-10-4-11-31-28)12-9-20(21)27(34-26)36-13-14-39-16-17(36)2/h4-8,10-11,17,22-23,29,32H,3,9,12-16H2,1-2H3/t17-,22?,23?/m0/s1 |
| InChIKey | KOQGBBTWURHVPF-YTZBPGPESA-N |
| XLogP | 1.63 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|