C23H12Cl2F6N2O — CID 59240310
1-(2,6-dichlorophenyl)-3-(trifluoromethyl)-5-[[4-(3,4,5-trifluorophenyl)phenoxy]methyl]pyrazole (PubChem CID 59240310) has the molecular formula C23H12Cl2F6N2O and a molecular weight of 517.26 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-(trifluoromethyl)-5-[[4-(3,4,5-trifluorophenyl)phenoxy]methyl]pyrazole.
| Compound Name | 1-(2,6-dichlorophenyl)-3-(trifluoromethyl)-5-[[4-(3,4,5-trifluorophenyl)phenoxy]methyl]pyrazole |
|---|---|
| PubChem CID | 59240310 |
| Molecular Formula | C23H12Cl2F6N2O |
| Molecular Weight | 517.26 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-(trifluoromethyl)-5-[[4-(3,4,5-trifluorophenyl)phenoxy]methyl]pyrazole |
| SMILES | Fc1cc(-c2ccc(OCc3cc(C(F)(F)F)nn3-c3c(Cl)cccc3Cl)cc2)cc(F)c1F |
| InChI | InChI=1S/C23H12Cl2F6N2O/c24-16-2-1-3-17(25)22(16)33-14(10-20(32-33)23(29,30)31)11-34-15-6-4-12(5-7-15)13-8-18(26)21(28)19(27)9-13/h1-10H,11H2 |
| InChIKey | PMUIKQSPCBCKMH-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.26 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|