C28H29N5O2 — CID 59240661
ethyl 6-[(2R)-4-(4-benzylphthalazin-1-yl)-2-methylpiperazin-1-yl]pyridine-3-carboxylate (PubChem CID 59240661) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is ethyl 6-[(2R)-4-(4-benzylphthalazin-1-yl)-2-methylpiperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[(2R)-4-(4-benzylphthalazin-1-yl)-2-methylpiperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59240661 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | ethyl 6-[(2R)-4-(4-benzylphthalazin-1-yl)-2-methylpiperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCN(c3nnc(Cc4ccccc4)c4ccccc34)C[C@H]2C)nc1 |
| InChI | InChI=1S/C28H29N5O2/c1-3-35-28(34)22-13-14-26(29-18-22)33-16-15-32(19-20(33)2)27-24-12-8-7-11-23(24)25(30-31-27)17-21-9-5-4-6-10-21/h4-14,18,20H,3,15-17,19H2,1-2H3/t20-/m1/s1 |
| InChIKey | AZTPRIPWSNDKNT-HXUWFJFHSA-N |
| XLogP | 4.51 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |