C23H25ClFN2O3+ — CID 59240715
(3R,4S)-7-chloro-4-[2-(4-fluorophenyl)ethylamino]-6-hydroxy-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-6-ium-3-ol (PubChem CID 59240715) has the molecular formula C23H25ClFN2O3+ and a molecular weight of 431.92 g/mol. Its IUPAC name is (3R,4S)-7-chloro-4-[2-(4-fluorophenyl)ethylamino]-6-hydroxy-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-6-ium-3-ol.
| Compound Name | (3R,4S)-7-chloro-4-[2-(4-fluorophenyl)ethylamino]-6-hydroxy-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-6-ium-3-ol |
|---|---|
| PubChem CID | 59240715 |
| Molecular Formula | C23H25ClFN2O3+ |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (3R,4S)-7-chloro-4-[2-(4-fluorophenyl)ethylamino]-6-hydroxy-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-6-ium-3-ol |
| SMILES | Cc1cc(Cl)[n+](O)c2cc3c(cc12)OC(C)(C)[C@H](O)[C@H]3NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H25ClFN2O3/c1-13-10-20(24)27(29)18-11-17-19(12-16(13)18)30-23(2,3)22(28)21(17)26-9-8-14-4-6-15(25)7-5-14/h4-7,10-12,21-22,26,28-29H,8-9H2,1-3H3/q+1/t21-,22+/m0/s1 |
| InChIKey | CHIKSEBWCPKKBI-FCHUYYIVSA-N |
| XLogP | 3.87 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|