About (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate
(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate (PubChem CID 592411) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate.
Molecular Properties
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate |
| PubChem CID | 592411 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate |
| SMILES | CC12CCC(C=C1OC(=O)CCC[N+](=O)[O-])C2(C)C |
| InChI | InChI=1S/C14H21NO4/c1-13(2)10-6-7-14(13,3)11(9-10)19-12(16)5-4-8-15(17)18/h9-10H,4-8H2,1-3H3 |
| InChIKey | VBNIQSKEDSJDGZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate?
The IUPAC name of (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate (CID 592411) is (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate.
What is the SMILES notation for (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate?
The canonical SMILES for (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate is CC12CCC(C=C1OC(=O)CCC[N+](=O)[O-])C2(C)C.
What is the InChIKey of (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate?
The InChIKey is VBNIQSKEDSJDGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-13(2)10-6-7-14(13,3)11(9-10)19-12(16)5-4-8-15(17)18/h9-10H,4-8H2,1-3H3.
What are the key properties of (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate?
(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate has a molecular weight of 267.32 g/mol, XLogP of 2.93, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl) 4-nitrobutanoate is sourced from PubChem (CID 592411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).