About 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione
6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione (PubChem CID 59241211) has the molecular formula C26H18ClNO4S
and a molecular weight of 475.95 g/mol. Its IUPAC name is 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione.
Molecular Properties
| Compound Name | 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione |
| PubChem CID | 59241211 |
| Molecular Formula | C26H18ClNO4S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione |
| SMILES | Cc1ccc2c3oc(=O)c(Sc4cccc(Cl)c4)c(O)c3c(=O)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C26H18ClNO4S/c1-15-10-11-19-20(12-15)28(14-16-6-3-2-4-7-16)25(30)21-22(29)24(26(31)32-23(19)21)33-18-9-5-8-17(27)13-18/h2-13,29H,14H2,1H3 |
| InChIKey | VITIMKXSFFYYDF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione?
The IUPAC name of 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione (CID 59241211) is 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione.
What is the SMILES notation for 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione?
The canonical SMILES for 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione is Cc1ccc2c3oc(=O)c(Sc4cccc(Cl)c4)c(O)c3c(=O)n(Cc3ccccc3)c2c1.
What is the InChIKey of 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione?
The InChIKey is VITIMKXSFFYYDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18ClNO4S/c1-15-10-11-19-20(12-15)28(14-16-6-3-2-4-7-16)25(30)21-22(29)24(26(31)32-23(19)21)33-18-9-5-8-17(27)13-18/h2-13,29H,14H2,1H3.
What are the key properties of 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione?
6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione has a molecular weight of 475.95 g/mol, XLogP of 5.97, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-3-(3-chlorophenyl)sulfanyl-4-hydroxy-8-methylpyrano[3,2-c]quinoline-2,5-dione is sourced from PubChem (CID 59241211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).