C28H17F2NO4S — CID 59241467
9-(4-fluorophenyl)-5-(3-fluorophenyl)sulfanyl-6-hydroxy-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),5,11,13,15-hexaene-4,8-dione (PubChem CID 59241467) has the molecular formula C28H17F2NO4S and a molecular weight of 501.51 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-5-(3-fluorophenyl)sulfanyl-6-hydroxy-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),5,11,13,15-hexaene-4,8-dione.
| Compound Name | 9-(4-fluorophenyl)-5-(3-fluorophenyl)sulfanyl-6-hydroxy-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),5,11,13,15-hexaene-4,8-dione |
|---|---|
| PubChem CID | 59241467 |
| Molecular Formula | C28H17F2NO4S |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | 9-(4-fluorophenyl)-5-(3-fluorophenyl)sulfanyl-6-hydroxy-3-oxa-9-azatetracyclo[8.8.0.02,7.011,16]octadeca-1(10),2(7),5,11,13,15-hexaene-4,8-dione |
| SMILES | O=c1oc2c3c(n(-c4ccc(F)cc4)c(=O)c2c(O)c1Sc1cccc(F)c1)-c1ccccc1CC3 |
| InChI | InChI=1S/C28H17F2NO4S/c29-16-9-11-18(12-10-16)31-23-20-7-2-1-4-15(20)8-13-21(23)25-22(27(31)33)24(32)26(28(34)35-25)36-19-6-3-5-17(30)14-19/h1-7,9-12,14,32H,8,13H2 |
| InChIKey | CKLZDWRMEYPFBR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |