C21H19FN2O3S — CID 59241572
3-(3-fluorophenyl)sulfanyl-4-hydroxy-7-methyl-1,6-bis(prop-2-enyl)-1,6-naphthyridine-2,5-dione (PubChem CID 59241572) has the molecular formula C21H19FN2O3S and a molecular weight of 398.46 g/mol. Its IUPAC name is 3-(3-fluorophenyl)sulfanyl-4-hydroxy-7-methyl-1,6-bis(prop-2-enyl)-1,6-naphthyridine-2,5-dione.
| Compound Name | 3-(3-fluorophenyl)sulfanyl-4-hydroxy-7-methyl-1,6-bis(prop-2-enyl)-1,6-naphthyridine-2,5-dione |
|---|---|
| PubChem CID | 59241572 |
| Molecular Formula | C21H19FN2O3S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 3-(3-fluorophenyl)sulfanyl-4-hydroxy-7-methyl-1,6-bis(prop-2-enyl)-1,6-naphthyridine-2,5-dione |
| SMILES | C=CCn1c(C)cc2c(c(O)c(Sc3cccc(F)c3)c(=O)n2CC=C)c1=O |
| InChI | InChI=1S/C21H19FN2O3S/c1-4-9-23-13(3)11-16-17(20(23)26)18(25)19(21(27)24(16)10-5-2)28-15-8-6-7-14(22)12-15/h4-8,11-12,25H,1-2,9-10H2,3H3 |
| InChIKey | RWICIKFOAYLMDX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|