C26H16ClNO4S — CID 59241878
5-(4-chlorophenyl)sulfanyl-6-hydroxy-10-phenyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione (PubChem CID 59241878) has the molecular formula C26H16ClNO4S and a molecular weight of 473.94 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfanyl-6-hydroxy-10-phenyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione.
| Compound Name | 5-(4-chlorophenyl)sulfanyl-6-hydroxy-10-phenyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione |
|---|---|
| PubChem CID | 59241878 |
| Molecular Formula | C26H16ClNO4S |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 5-(4-chlorophenyl)sulfanyl-6-hydroxy-10-phenyl-3-oxa-9-azatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2(7),5,12(16),13-pentaene-4,8-dione |
| SMILES | O=c1oc2c(c(O)c1Sc1ccc(Cl)cc1)c(=O)n1c3c(cccc23)CC1c1ccccc1 |
| InChI | InChI=1S/C26H16ClNO4S/c27-16-9-11-17(12-10-16)33-24-22(29)20-23(32-26(24)31)18-8-4-7-15-13-19(14-5-2-1-3-6-14)28(21(15)18)25(20)30/h1-12,19,29H,13H2 |
| InChIKey | JJGIDVZHXNKGGK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|