C22H24ClFN4O4 — CID 59242245
(E)-3-[5-chloro-6-[[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 59242245) has the molecular formula C22H24ClFN4O4 and a molecular weight of 462.91 g/mol. Its IUPAC name is (E)-3-[5-chloro-6-[[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[5-chloro-6-[[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 59242245 |
| Molecular Formula | C22H24ClFN4O4 |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (E)-3-[5-chloro-6-[[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnc(NCC(=O)NCc2ccc(F)cc2)c(Cl)c1)NOC1CCCCO1 |
| InChI | InChI=1S/C22H24ClFN4O4/c23-18-11-16(6-9-19(29)28-32-21-3-1-2-10-31-21)13-26-22(18)27-14-20(30)25-12-15-4-7-17(24)8-5-15/h4-9,11,13,21H,1-3,10,12,14H2,(H,25,30)(H,26,27)(H,28,29)/b9-6+ |
| InChIKey | HTLMLFWNJWOGFW-RMKNXTFCSA-N |
| XLogP | 3.19 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|