C20H21N6O6P — CID 59243321
[(3R,3aS)-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate (PubChem CID 59243321) has the molecular formula C20H21N6O6P and a molecular weight of 472.40 g/mol. Its IUPAC name is [(3R,3aS)-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate.
| Compound Name | [(3R,3aS)-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 59243321 |
| Molecular Formula | C20H21N6O6P |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [(3R,3aS)-1-oxo-6-[6-[(2H-triazol-4-ylmethylamino)methyl]-3-pyridinyl]-3a,4-dihydro-3H-[1,3]oxazolo[3,4-a]indol-3-yl]methyl dihydrogen phosphate |
| SMILES | O=C1O[C@@H](COP(=O)(O)O)[C@@H]2Cc3cc(-c4ccc(CNCc5cn[nH]n5)nc4)ccc3N12 |
| InChI | InChI=1S/C20H21N6O6P/c27-20-26-17-4-2-12(5-14(17)6-18(26)19(32-20)11-31-33(28,29)30)13-1-3-15(22-7-13)8-21-9-16-10-23-25-24-16/h1-5,7,10,18-19,21H,6,8-9,11H2,(H,23,24,25)(H2,28,29,30)/t18-,19-/m0/s1 |
| InChIKey | UQOQCBILUSMPQE-OALUTQOASA-N |
| XLogP | 1.52 |
| TPSA | 162.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|