C23H21F3O4 — CID 59243445
(4bR,7S,8aR)-4b-benzyl-7-hydroxy-6-oxo-7-(trifluoromethyl)-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxylic acid (PubChem CID 59243445) has the molecular formula C23H21F3O4 and a molecular weight of 418.41 g/mol. Its IUPAC name is (4bR,7S,8aR)-4b-benzyl-7-hydroxy-6-oxo-7-(trifluoromethyl)-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxylic acid.
| Compound Name | (4bR,7S,8aR)-4b-benzyl-7-hydroxy-6-oxo-7-(trifluoromethyl)-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxylic acid |
|---|---|
| PubChem CID | 59243445 |
| Molecular Formula | C23H21F3O4 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (4bR,7S,8aR)-4b-benzyl-7-hydroxy-6-oxo-7-(trifluoromethyl)-8,8a,9,10-tetrahydro-5H-phenanthrene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)CC[C@@H]1C[C@@](O)(C(F)(F)F)C(=O)C[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C23H21F3O4/c24-23(25,26)22(30)12-17-8-6-15-10-16(20(28)29)7-9-18(15)21(17,13-19(22)27)11-14-4-2-1-3-5-14/h1-5,7,9-10,17,30H,6,8,11-13H2,(H,28,29)/t17-,21-,22+/m1/s1 |
| InChIKey | KUWAZQHPVNVDAU-YHYVQYDKSA-N |
| XLogP | 4.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |