C31H58N3O3P — CID 59243537
2-[[(1S,4aS,8aS)-5-[heptyl(methyl)amino]-4a-methyl-1-propyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxyacetyl isocyanide (PubChem CID 59243537) has the molecular formula C31H58N3O3P and a molecular weight of 551.80 g/mol. Its IUPAC name is 2-[[(1S,4aS,8aS)-5-[heptyl(methyl)amino]-4a-methyl-1-propyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxyacetyl isocyanide.
| Compound Name | 2-[[(1S,4aS,8aS)-5-[heptyl(methyl)amino]-4a-methyl-1-propyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxyacetyl isocyanide |
|---|---|
| PubChem CID | 59243537 |
| Molecular Formula | C31H58N3O3P |
| Molecular Weight | 551.80 g/mol |
| Exact Mass | 551.42 |
| IUPAC Name | 2-[[(1S,4aS,8aS)-5-[heptyl(methyl)amino]-4a-methyl-1-propyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxyacetyl isocyanide |
| SMILES | [C-]#[N+]C(=O)COP(OC1CC[C@]2(C)C(N(C)CCCCCCC)CCC[C@H]2[C@@H]1CCC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C31H58N3O3P/c1-10-12-13-14-15-22-33(9)29-19-16-18-27-26(17-11-2)28(20-21-31(27,29)7)37-38(36-23-30(35)32-8)34(24(3)4)25(5)6/h24-29H,10-23H2,1-7,9H3/t26-,27-,28?,29?,31-,38?/m0/s1 |
| InChIKey | LRIFYASARLATIJ-LSHGFXBYSA-N |
| XLogP | 8.47 |
| TPSA | 46.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.80 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|