C22H28N2O11S — CID 59243543
1-[(4R,6R,6aS)-2,2-dimethyl-6-[2-(trioxidanylsulfanyloxy)ethoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 59243543) has the molecular formula C22H28N2O11S and a molecular weight of 528.54 g/mol. Its IUPAC name is 1-[(4R,6R,6aS)-2,2-dimethyl-6-[2-(trioxidanylsulfanyloxy)ethoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(4R,6R,6aS)-2,2-dimethyl-6-[2-(trioxidanylsulfanyloxy)ethoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59243543 |
| Molecular Formula | C22H28N2O11S |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 1-[(4R,6R,6aS)-2,2-dimethyl-6-[2-(trioxidanylsulfanyloxy)ethoxymethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | CC1(C)OC2[C@@H](O1)[C@@H](COCCOSOOO)O[C@H]2n1ccc(=O)n(COCc2ccccc2)c1=O |
| InChI | InChI=1S/C22H28N2O11S/c1-22(2)32-18-16(13-28-10-11-30-36-35-34-27)31-20(19(18)33-22)23-9-8-17(25)24(21(23)26)14-29-12-15-6-4-3-5-7-15/h3-9,16,18-20,27H,10-14H2,1-2H3/t16-,18+,19?,20-/m1/s1 |
| InChIKey | JXAKXVCLDKEJGA-FFLWXPKWSA-N |
| XLogP | 1.62 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|