C19H13Br3S — CID 59244085
1,9,10-tribromo-7,7-dimethylbenzo[c]fluorene-5-thiol (PubChem CID 59244085) has the molecular formula C19H13Br3S and a molecular weight of 513.09 g/mol. Its IUPAC name is 1,9,10-tribromo-7,7-dimethylbenzo[c]fluorene-5-thiol.
| Compound Name | 1,9,10-tribromo-7,7-dimethylbenzo[c]fluorene-5-thiol |
|---|---|
| PubChem CID | 59244085 |
| Molecular Formula | C19H13Br3S |
| Molecular Weight | 513.09 g/mol |
| Exact Mass | 509.83 |
| IUPAC Name | 1,9,10-tribromo-7,7-dimethylbenzo[c]fluorene-5-thiol |
| SMILES | CC1(C)c2cc(Br)c(Br)cc2-c2c1cc(S)c1cccc(Br)c21 |
| InChI | InChI=1S/C19H13Br3S/c1-19(2)11-7-15(22)14(21)6-10(11)17-12(19)8-16(23)9-4-3-5-13(20)18(9)17/h3-8,23H,1-2H3 |
| InChIKey | BYHLBCPTQXFEBY-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.09 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|