C19H23NO3 — CID 59245123
(5S)-2-(2,6-dimethoxyphenyl)-3,5-dimethyl-4-phenyl-1,3-oxazolidine (PubChem CID 59245123) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (5S)-2-(2,6-dimethoxyphenyl)-3,5-dimethyl-4-phenyl-1,3-oxazolidine.
| Compound Name | (5S)-2-(2,6-dimethoxyphenyl)-3,5-dimethyl-4-phenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 59245123 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (5S)-2-(2,6-dimethoxyphenyl)-3,5-dimethyl-4-phenyl-1,3-oxazolidine |
| SMILES | COc1cccc(OC)c1C1O[C@@H](C)C(c2ccccc2)N1C |
| InChI | InChI=1S/C19H23NO3/c1-13-18(14-9-6-5-7-10-14)20(2)19(23-13)17-15(21-3)11-8-12-16(17)22-4/h5-13,18-19H,1-4H3/t13-,18?,19?/m0/s1 |
| InChIKey | VXJAMXKUTWNLOM-MDAWKPQNSA-N |
| XLogP | 3.79 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |