C10H17N3O7 — CID 59245379
1-(2,3-dihydroxypropyl)-3,5-bis(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 59245379) has the molecular formula C10H17N3O7 and a molecular weight of 291.26 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-3,5-bis(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(2,3-dihydroxypropyl)-3,5-bis(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59245379 |
| Molecular Formula | C10H17N3O7 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-3,5-bis(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(CCO)c(=O)n(CC(O)CO)c(=O)n1CCO |
| InChI | InChI=1S/C10H17N3O7/c14-3-1-11-8(18)12(2-4-15)10(20)13(9(11)19)5-7(17)6-16/h7,14-17H,1-6H2 |
| InChIKey | GISPGDJAHGIGNA-UHFFFAOYSA-N |
| XLogP | -4.49 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |