C15H4Br2F6I2 — CID 59245679
3,6-dibromo-2,7-diiodo-9,9-bis(trifluoromethyl)fluorene (PubChem CID 59245679) has the molecular formula C15H4Br2F6I2 and a molecular weight of 711.80 g/mol. Its IUPAC name is 3,6-dibromo-2,7-diiodo-9,9-bis(trifluoromethyl)fluorene.
| Compound Name | 3,6-dibromo-2,7-diiodo-9,9-bis(trifluoromethyl)fluorene |
|---|---|
| PubChem CID | 59245679 |
| Molecular Formula | C15H4Br2F6I2 |
| Molecular Weight | 711.80 g/mol |
| Exact Mass | 709.67 |
| IUPAC Name | 3,6-dibromo-2,7-diiodo-9,9-bis(trifluoromethyl)fluorene |
| SMILES | FC(F)(F)C1(C(F)(F)F)c2cc(I)c(Br)cc2-c2cc(Br)c(I)cc21 |
| InChI | InChI=1S/C15H4Br2F6I2/c16-9-1-5-6-2-10(17)12(25)4-8(6)13(14(18,19)20,15(21,22)23)7(5)3-11(9)24/h1-4H |
| InChIKey | PKNAXLMGQNNXHF-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.80 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|