C59H72N2 — CID 59246614
2-[9-(1,3,4,5,6,7-hexamethylindol-2-yl)-1,2,3,4,5,6,8-heptamethyl-7-(2,3,4,5,6-pentamethylphenyl)fluoren-9-yl]-1,3,4,5,6,7-hexamethylindole (PubChem CID 59246614) has the molecular formula C59H72N2 and a molecular weight of 809.24 g/mol. Its IUPAC name is 2-[9-(1,3,4,5,6,7-hexamethylindol-2-yl)-1,2,3,4,5,6,8-heptamethyl-7-(2,3,4,5,6-pentamethylphenyl)fluoren-9-yl]-1,3,4,5,6,7-hexamethylindole.
| Compound Name | 2-[9-(1,3,4,5,6,7-hexamethylindol-2-yl)-1,2,3,4,5,6,8-heptamethyl-7-(2,3,4,5,6-pentamethylphenyl)fluoren-9-yl]-1,3,4,5,6,7-hexamethylindole |
|---|---|
| PubChem CID | 59246614 |
| Molecular Formula | C59H72N2 |
| Molecular Weight | 809.24 g/mol |
| Exact Mass | 808.57 |
| IUPAC Name | 2-[9-(1,3,4,5,6,7-hexamethylindol-2-yl)-1,2,3,4,5,6,8-heptamethyl-7-(2,3,4,5,6-pentamethylphenyl)fluoren-9-yl]-1,3,4,5,6,7-hexamethylindole |
| SMILES | Cc1c(C)c(C)c(-c2c(C)c(C)c3c(c2C)C(c2c(C)c4c(C)c(C)c(C)c(C)c4n2C)(c2c(C)c4c(C)c(C)c(C)c(C)c4n2C)c2c(C)c(C)c(C)c(C)c2-3)c(C)c1C |
| InChI | InChI=1S/C59H72N2/c1-25-26(2)34(10)47(35(11)27(25)3)48-39(15)40(16)52-51-38(14)28(4)31(7)41(17)53(51)59(54(52)44(48)20,57-45(21)49-36(12)29(5)32(8)42(18)55(49)60(57)23)58-46(22)50-37(13)30(6)33(9)43(19)56(50)61(58)24/h1-24H3 |
| InChIKey | NMNGWLAJQHZJLL-UHFFFAOYSA-N |
| XLogP | 15.49 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.24 |
| LogP ≤ 5 | 15.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |