C26H30N8 — CID 59246649
1-[3,6-dimethyl-5-(4,5,6,7-tetramethylbenzotriazol-1-yl)pyrazin-2-yl]-4,5,6,7-tetramethylbenzotriazole (PubChem CID 59246649) has the molecular formula C26H30N8 and a molecular weight of 454.58 g/mol. Its IUPAC name is 1-[3,6-dimethyl-5-(4,5,6,7-tetramethylbenzotriazol-1-yl)pyrazin-2-yl]-4,5,6,7-tetramethylbenzotriazole.
| Compound Name | 1-[3,6-dimethyl-5-(4,5,6,7-tetramethylbenzotriazol-1-yl)pyrazin-2-yl]-4,5,6,7-tetramethylbenzotriazole |
|---|---|
| PubChem CID | 59246649 |
| Molecular Formula | C26H30N8 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 1-[3,6-dimethyl-5-(4,5,6,7-tetramethylbenzotriazol-1-yl)pyrazin-2-yl]-4,5,6,7-tetramethylbenzotriazole |
| SMILES | Cc1nc(-n2nnc3c(C)c(C)c(C)c(C)c32)c(C)nc1-n1nnc2c(C)c(C)c(C)c(C)c21 |
| InChI | InChI=1S/C26H30N8/c1-11-13(3)17(7)23-21(15(11)5)29-31-33(23)25-19(9)28-26(20(10)27-25)34-24-18(8)14(4)12(2)16(6)22(24)30-32-34/h1-10H3 |
| InChIKey | MRGBRMDHWNRHKW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |