C23H13F7 — CID 59246893
2-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-5-(4-ethylphenyl)-1,3-difluorobenzene (PubChem CID 59246893) has the molecular formula C23H13F7 and a molecular weight of 422.34 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-5-(4-ethylphenyl)-1,3-difluorobenzene.
| Compound Name | 2-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-5-(4-ethylphenyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 59246893 |
| Molecular Formula | C23H13F7 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-5-(4-ethylphenyl)-1,3-difluorobenzene |
| SMILES | CCc1ccc(-c2cc(F)c(-c3cc(F)c(C#CC(F)(F)F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C23H13F7/c1-2-13-3-5-14(6-4-13)15-9-20(26)22(21(27)10-15)16-11-18(24)17(19(25)12-16)7-8-23(28,29)30/h3-6,9-12H,2H2,1H3 |
| InChIKey | BRVYBPOPPHXOHK-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|