C11H20NOY- — CID 59247985
1-(1,2,3,4,5-pentamethylpyrrolidin-4-id-2-yl)ethanone;yttrium (PubChem CID 59247985) has the molecular formula C11H20NOY- and a molecular weight of 271.19 g/mol. Its IUPAC name is 1-(1,2,3,4,5-pentamethylpyrrolidin-4-id-2-yl)ethanone;yttrium.
| Compound Name | 1-(1,2,3,4,5-pentamethylpyrrolidin-4-id-2-yl)ethanone;yttrium |
|---|---|
| PubChem CID | 59247985 |
| Molecular Formula | C11H20NOY- |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-(1,2,3,4,5-pentamethylpyrrolidin-4-id-2-yl)ethanone;yttrium |
| SMILES | CC(=O)C1(C)C(C)[C-](C)C(C)N1C.[Y] |
| InChI | InChI=1S/C11H20NO.Y/c1-7-8(2)11(5,10(4)13)12(6)9(7)3;/h8-9H,1-6H3;/q-1; |
| InChIKey | XJTJEQFWRMIQRJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|