C13H13F13 — CID 59248249
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylcycloheptane (PubChem CID 59248249) has the molecular formula C13H13F13 and a molecular weight of 416.22 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylcycloheptane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylcycloheptane |
|---|---|
| PubChem CID | 59248249 |
| Molecular Formula | C13H13F13 |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylcycloheptane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CCCCCC1 |
| InChI | InChI=1S/C13H13F13/c14-8(15,7-5-3-1-2-4-6-7)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h7H,1-6H2 |
| InChIKey | KCMYVTIXGOYZPG-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|