About 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium
3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium (PubChem CID 59248403) has the molecular formula C27H24O3P+
and a molecular weight of 427.46 g/mol. Its IUPAC name is 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium.
Molecular Properties
| Compound Name | 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium |
| PubChem CID | 59248403 |
| Molecular Formula | C27H24O3P+ |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium |
| SMILES | O=C1C=CC(=O)C(OCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C27H24O3P/c28-22-17-18-26(29)27(21-22)30-19-10-20-31(23-11-4-1-5-12-23,24-13-6-2-7-14-24)25-15-8-3-9-16-25/h1-9,11-18,21H,10,19-20H2/q+1 |
| InChIKey | DSNRZWGGHVWFEO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium?
The IUPAC name of 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium (CID 59248403) is 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium.
What is the SMILES notation for 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium?
The canonical SMILES for 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium is O=C1C=CC(=O)C(OCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)=C1.
What is the InChIKey of 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium?
The InChIKey is DSNRZWGGHVWFEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24O3P/c28-22-17-18-26(29)27(21-22)30-19-10-20-31(23-11-4-1-5-12-23,24-13-6-2-7-14-24)25-15-8-3-9-16-25/h1-9,11-18,21H,10,19-20H2/q+1.
What are the key properties of 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium?
3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium has a molecular weight of 427.46 g/mol, XLogP of 3.98, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxypropyl-triphenylphosphanium is sourced from PubChem (CID 59248403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).