C21H37N — CID 59248580
N-[(1E,3E,5E,7E)-deca-1,3,5,7-tetraenyl]-N-methyldecan-1-amine (PubChem CID 59248580) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is N-[(1E,3E,5E,7E)-deca-1,3,5,7-tetraenyl]-N-methyldecan-1-amine.
| Compound Name | N-[(1E,3E,5E,7E)-deca-1,3,5,7-tetraenyl]-N-methyldecan-1-amine |
|---|---|
| PubChem CID | 59248580 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | N-[(1E,3E,5E,7E)-deca-1,3,5,7-tetraenyl]-N-methyldecan-1-amine |
| SMILES | CC/C=C/C=C/C=C/C=C/N(C)CCCCCCCCCC |
| InChI | InChI=1S/C21H37N/c1-4-6-8-10-12-14-16-18-20-22(3)21-19-17-15-13-11-9-7-5-2/h6,8,10,12,14,16,18,20H,4-5,7,9,11,13,15,17,19,21H2,1-3H3/b8-6+,12-10+,16-14+,20-18+ |
| InChIKey | LKJUVLIMQVGHKS-KOIAXVQNSA-N |
| XLogP | 6.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|