About N-methyltricyclo[3.1.1.03,6]heptan-2-amine
N-methyltricyclo[3.1.1.03,6]heptan-2-amine (PubChem CID 59248622) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is N-methyltricyclo[3.1.1.03,6]heptan-2-amine.
Molecular Properties
| Compound Name | N-methyltricyclo[3.1.1.03,6]heptan-2-amine |
| PubChem CID | 59248622 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | N-methyltricyclo[3.1.1.03,6]heptan-2-amine |
| SMILES | CNC1C2CC3CC1C32 |
| InChI | InChI=1S/C8H13N/c1-9-8-5-2-4-3-6(8)7(4)5/h4-9H,2-3H2,1H3 |
| InChIKey | ULIGELVVWYFXKE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyltricyclo[3.1.1.03,6]heptan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyltricyclo[3.1.1.03,6]heptan-2-amine?
The IUPAC name of N-methyltricyclo[3.1.1.03,6]heptan-2-amine (CID 59248622) is N-methyltricyclo[3.1.1.03,6]heptan-2-amine.
What is the SMILES notation for N-methyltricyclo[3.1.1.03,6]heptan-2-amine?
The canonical SMILES for N-methyltricyclo[3.1.1.03,6]heptan-2-amine is CNC1C2CC3CC1C32.
What is the InChIKey of N-methyltricyclo[3.1.1.03,6]heptan-2-amine?
The InChIKey is ULIGELVVWYFXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-9-8-5-2-4-3-6(8)7(4)5/h4-9H,2-3H2,1H3.
What are the key properties of N-methyltricyclo[3.1.1.03,6]heptan-2-amine?
N-methyltricyclo[3.1.1.03,6]heptan-2-amine has a molecular weight of 123.20 g/mol, XLogP of 0.86, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyltricyclo[3.1.1.03,6]heptan-2-amine is sourced from PubChem (CID 59248622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).