About 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide
2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide (PubChem CID 59248741) has the molecular formula C13H23N5O2
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide |
| PubChem CID | 59248741 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide |
| SMILES | NC(=O)C[C@H]1CC2(CC2)[C@@H](CCCN=C(N)N)C(=O)N1 |
| InChI | InChI=1S/C13H23N5O2/c14-10(19)6-8-7-13(3-4-13)9(11(20)18-8)2-1-5-17-12(15)16/h8-9H,1-7H2,(H2,14,19)(H,18,20)(H4,15,16,17)/t8-,9-/m0/s1 |
| InChIKey | PNBFAUNFKPYKSQ-IUCAKERBSA-N |
| XLogP | -0.80 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide?
The IUPAC name of 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide (CID 59248741) is 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide.
What is the SMILES notation for 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide?
The canonical SMILES for 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide is NC(=O)C[C@H]1CC2(CC2)[C@@H](CCCN=C(N)N)C(=O)N1.
What is the InChIKey of 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide?
The InChIKey is PNBFAUNFKPYKSQ-IUCAKERBSA-N. The full InChI is InChI=1S/C13H23N5O2/c14-10(19)6-8-7-13(3-4-13)9(11(20)18-8)2-1-5-17-12(15)16/h8-9H,1-7H2,(H2,14,19)(H,18,20)(H4,15,16,17)/t8-,9-/m0/s1.
What are the key properties of 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide?
2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide has a molecular weight of 281.36 g/mol, XLogP of -0.80, 6 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5R,8R)-8-[3-(diaminomethylideneamino)propyl]-7-oxo-6-azaspiro[2.5]octan-5-yl]acetamide is sourced from PubChem (CID 59248741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).