About (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one
(3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one (PubChem CID 59248753) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one.
Molecular Properties
| Compound Name | (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one |
| PubChem CID | 59248753 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one |
| SMILES | CC(=O)[C@H]1CN(C)[C@H](C)C(=O)N1 |
| InChI | InChI=1S/C8H14N2O2/c1-5-8(12)9-7(6(2)11)4-10(5)3/h5,7H,4H2,1-3H3,(H,9,12)/t5-,7-/m1/s1 |
| InChIKey | ZBWVUYOJNDJARU-IYSWYEEDSA-N |
| XLogP | -0.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one?
The IUPAC name of (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one (CID 59248753) is (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one.
What is the SMILES notation for (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one?
The canonical SMILES for (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one is CC(=O)[C@H]1CN(C)[C@H](C)C(=O)N1.
What is the InChIKey of (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one?
The InChIKey is ZBWVUYOJNDJARU-IYSWYEEDSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-5-8(12)9-7(6(2)11)4-10(5)3/h5,7H,4H2,1-3H3,(H,9,12)/t5-,7-/m1/s1.
What are the key properties of (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one?
(3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one has a molecular weight of 170.21 g/mol, XLogP of -0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6R)-6-acetyl-3,4-dimethylpiperazin-2-one is sourced from PubChem (CID 59248753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).