C8H4F8 — CID 592488
1,2,3,4,5,5,6,6-octafluorobicyclo[2.2.2]oct-2-ene (PubChem CID 592488) has the molecular formula C8H4F8 and a molecular weight of 252.10 g/mol. Its IUPAC name is 1,2,3,4,5,5,6,6-octafluorobicyclo[2.2.2]oct-2-ene.
| Compound Name | 1,2,3,4,5,5,6,6-octafluorobicyclo[2.2.2]oct-2-ene |
|---|---|
| PubChem CID | 592488 |
| Molecular Formula | C8H4F8 |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 1,2,3,4,5,5,6,6-octafluorobicyclo[2.2.2]oct-2-ene |
| SMILES | FC1=C(F)C2(F)CCC1(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C8H4F8/c9-3-4(10)6(12)2-1-5(3,11)7(13,14)8(6,15)16/h1-2H2 |
| InChIKey | MILCJPLPEMJWKH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|