C3H9N — CID 59248895
1,1,2,2,3,3,3-heptadeuteriopropan-1-amine (PubChem CID 59248895) has the molecular formula C3H9N and a molecular weight of 66.15 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptadeuteriopropan-1-amine.
| Compound Name | 1,1,2,2,3,3,3-heptadeuteriopropan-1-amine |
|---|---|
| PubChem CID | 59248895 |
| Molecular Formula | C3H9N |
| Molecular Weight | 66.15 g/mol |
| Exact Mass | 66.12 |
| IUPAC Name | 1,1,2,2,3,3,3-heptadeuteriopropan-1-amine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])N |
| InChI | InChI=1S/C3H9N/c1-2-3-4/h2-4H2,1H3/i1D3,2D2,3D2 |
| InChIKey | WGYKZJWCGVVSQN-NCKGIQLSSA-N |
| XLogP | 0.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 4 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 66.15 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |