About 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid
4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid (PubChem CID 59248920) has the molecular formula C26H29NO3
and a molecular weight of 403.52 g/mol. Its IUPAC name is 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid |
| PubChem CID | 59248920 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid |
| SMILES | CC1(C)C(=O)N(C2C3CC4CC2CC(C(=O)O)(C4)C3)C1c1cccc2ccccc12 |
| InChI | InChI=1S/C26H29NO3/c1-25(2)22(20-9-5-7-16-6-3-4-8-19(16)20)27(23(25)28)21-17-10-15-11-18(21)14-26(12-15,13-17)24(29)30/h3-9,15,17-18,21-22H,10-14H2,1-2H3,(H,29,30) |
| InChIKey | SGWXNXQSYASWMU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid?
The IUPAC name of 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid (CID 59248920) is 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid.
What is the SMILES notation for 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid?
The canonical SMILES for 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid is CC1(C)C(=O)N(C2C3CC4CC2CC(C(=O)O)(C4)C3)C1c1cccc2ccccc12.
What is the InChIKey of 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid?
The InChIKey is SGWXNXQSYASWMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29NO3/c1-25(2)22(20-9-5-7-16-6-3-4-8-19(16)20)27(23(25)28)21-17-10-15-11-18(21)14-26(12-15,13-17)24(29)30/h3-9,15,17-18,21-22H,10-14H2,1-2H3,(H,29,30).
What are the key properties of 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid?
4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid has a molecular weight of 403.52 g/mol, XLogP of 5.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethyl-2-naphthalen-1-yl-4-oxoazetidin-1-yl)adamantane-1-carboxylic acid is sourced from PubChem (CID 59248920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).