About 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one
4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one (PubChem CID 59248926) has the molecular formula C21H24Cl2FNO
and a molecular weight of 396.33 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one.
Molecular Properties
| Compound Name | 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one |
| PubChem CID | 59248926 |
| Molecular Formula | C21H24Cl2FNO |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one |
| SMILES | CC1(C)C(=O)N(C2C3CC4CC2CC(F)(C4)C3)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H24Cl2FNO/c1-20(2)18(14-4-3-5-15(22)16(14)23)25(19(20)26)17-12-6-11-7-13(17)10-21(24,8-11)9-12/h3-5,11-13,17-18H,6-10H2,1-2H3 |
| InChIKey | XPTGQBXLAWEJQG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one?
The IUPAC name of 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one (CID 59248926) is 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one.
What is the SMILES notation for 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one?
The canonical SMILES for 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one is CC1(C)C(=O)N(C2C3CC4CC2CC(F)(C4)C3)C1c1cccc(Cl)c1Cl.
What is the InChIKey of 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one?
The InChIKey is XPTGQBXLAWEJQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24Cl2FNO/c1-20(2)18(14-4-3-5-15(22)16(14)23)25(19(20)26)17-12-6-11-7-13(17)10-21(24,8-11)9-12/h3-5,11-13,17-18H,6-10H2,1-2H3.
What are the key properties of 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one?
4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one has a molecular weight of 396.33 g/mol, XLogP of 5.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dichlorophenyl)-1-(5-fluoro-2-adamantyl)-3,3-dimethylazetidin-2-one is sourced from PubChem (CID 59248926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).