About tert-butyl 2-(3,3-dimethylbutylideneamino)acetate
tert-butyl 2-(3,3-dimethylbutylideneamino)acetate (PubChem CID 59249587) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is tert-butyl 2-(3,3-dimethylbutylideneamino)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(3,3-dimethylbutylideneamino)acetate |
| PubChem CID | 59249587 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | tert-butyl 2-(3,3-dimethylbutylideneamino)acetate |
| SMILES | CC(C)(C)C/C=N/CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO2/c1-11(2,3)7-8-13-9-10(14)15-12(4,5)6/h8H,7,9H2,1-6H3/b13-8+ |
| InChIKey | LQTWVCIRWXUXSW-MDWZMJQESA-N |
| XLogP | 2.84 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(3,3-dimethylbutylideneamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(3,3-dimethylbutylideneamino)acetate?
The IUPAC name of tert-butyl 2-(3,3-dimethylbutylideneamino)acetate (CID 59249587) is tert-butyl 2-(3,3-dimethylbutylideneamino)acetate.
What is the SMILES notation for tert-butyl 2-(3,3-dimethylbutylideneamino)acetate?
The canonical SMILES for tert-butyl 2-(3,3-dimethylbutylideneamino)acetate is CC(C)(C)C/C=N/CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-(3,3-dimethylbutylideneamino)acetate?
The InChIKey is LQTWVCIRWXUXSW-MDWZMJQESA-N. The full InChI is InChI=1S/C12H23NO2/c1-11(2,3)7-8-13-9-10(14)15-12(4,5)6/h8H,7,9H2,1-6H3/b13-8+.
What are the key properties of tert-butyl 2-(3,3-dimethylbutylideneamino)acetate?
tert-butyl 2-(3,3-dimethylbutylideneamino)acetate has a molecular weight of 213.32 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(3,3-dimethylbutylideneamino)acetate is sourced from PubChem (CID 59249587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).