C33H20Cl2F6N2O4 — CID 59249721
(2,3,4,5,6-pentafluorophenyl) 1-[(4-chloro-3-fluorophenyl)methyl]-2-(6-chloro-1H-indol-3-yl)-3-(4-methylphenoxy)-5-oxopyrrolidine-3-carboxylate (PubChem CID 59249721) has the molecular formula C33H20Cl2F6N2O4 and a molecular weight of 693.43 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 1-[(4-chloro-3-fluorophenyl)methyl]-2-(6-chloro-1H-indol-3-yl)-3-(4-methylphenoxy)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 1-[(4-chloro-3-fluorophenyl)methyl]-2-(6-chloro-1H-indol-3-yl)-3-(4-methylphenoxy)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 59249721 |
| Molecular Formula | C33H20Cl2F6N2O4 |
| Molecular Weight | 693.43 g/mol |
| Exact Mass | 692.07 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 1-[(4-chloro-3-fluorophenyl)methyl]-2-(6-chloro-1H-indol-3-yl)-3-(4-methylphenoxy)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(OC2(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)CC(=O)N(Cc3ccc(Cl)c(F)c3)C2c2c[nH]c3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C33H20Cl2F6N2O4/c1-15-2-6-18(7-3-15)47-33(32(45)46-30-28(40)26(38)25(37)27(39)29(30)41)12-24(44)43(14-16-4-9-21(35)22(36)10-16)31(33)20-13-42-23-11-17(34)5-8-19(20)23/h2-11,13,31,42H,12,14H2,1H3 |
| InChIKey | DMBKLVZFMNPFLU-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.43 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|