C19H17Cl2N5OS — CID 59249998
(3S,5R)-4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-3,5-dimethylmorpholine (PubChem CID 59249998) has the molecular formula C19H17Cl2N5OS and a molecular weight of 434.35 g/mol. Its IUPAC name is (3S,5R)-4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-3,5-dimethylmorpholine.
| Compound Name | (3S,5R)-4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-3,5-dimethylmorpholine |
|---|---|
| PubChem CID | 59249998 |
| Molecular Formula | C19H17Cl2N5OS |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (3S,5R)-4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-3,5-dimethylmorpholine |
| SMILES | [C-]#[N+]c1c(N2[C@H](C)COC[C@@H]2C)sc(-c2ncn[nH]2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2N5OS/c1-10-7-27-8-11(2)26(10)19-16(22-3)15(13-5-4-12(20)6-14(13)21)17(28-19)18-23-9-24-25-18/h4-6,9-11H,7-8H2,1-2H3,(H,23,24,25)/t10-,11+ |
| InChIKey | MGUHFJHUIMSGQC-PHIMTYICSA-N |
| XLogP | 5.67 |
| TPSA | 58.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|