C18H15Cl2N5OS — CID 59250000
4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-1,4-oxazepane (PubChem CID 59250000) has the molecular formula C18H15Cl2N5OS and a molecular weight of 420.33 g/mol. Its IUPAC name is 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-1,4-oxazepane.
| Compound Name | 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-1,4-oxazepane |
|---|---|
| PubChem CID | 59250000 |
| Molecular Formula | C18H15Cl2N5OS |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-1,4-oxazepane |
| SMILES | [C-]#[N+]c1c(N2CCCOCC2)sc(-c2ncn[nH]2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2N5OS/c1-21-15-14(12-4-3-11(19)9-13(12)20)16(17-22-10-23-24-17)27-18(15)25-5-2-7-26-8-6-25/h3-4,9-10H,2,5-8H2,(H,22,23,24) |
| InChIKey | HNJSEDFBTFFSCR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|