C19H17Cl2N5OS — CID 59250004
(2R)-4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-ethylmorpholine (PubChem CID 59250004) has the molecular formula C19H17Cl2N5OS and a molecular weight of 434.35 g/mol. Its IUPAC name is (2R)-4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-ethylmorpholine.
| Compound Name | (2R)-4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-ethylmorpholine |
|---|---|
| PubChem CID | 59250004 |
| Molecular Formula | C19H17Cl2N5OS |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (2R)-4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-ethylmorpholine |
| SMILES | [C-]#[N+]c1c(N2CCO[C@H](CC)C2)sc(-c2ncn[nH]2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2N5OS/c1-3-12-9-26(6-7-27-12)19-16(22-2)15(13-5-4-11(20)8-14(13)21)17(28-19)18-23-10-24-25-18/h4-5,8,10,12H,3,6-7,9H2,1H3,(H,23,24,25)/t12-/m1/s1 |
| InChIKey | OHIJUAXVKKCNNO-GFCCVEGCSA-N |
| XLogP | 5.67 |
| TPSA | 58.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|