C18H14Cl2FN5OS — CID 59250008
4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-(fluoromethyl)morpholine (PubChem CID 59250008) has the molecular formula C18H14Cl2FN5OS and a molecular weight of 438.32 g/mol. Its IUPAC name is 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-(fluoromethyl)morpholine.
| Compound Name | 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-(fluoromethyl)morpholine |
|---|---|
| PubChem CID | 59250008 |
| Molecular Formula | C18H14Cl2FN5OS |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-(fluoromethyl)morpholine |
| SMILES | [C-]#[N+]c1c(N2CCOC(CF)C2)sc(-c2ncn[nH]2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl2FN5OS/c1-22-15-14(12-3-2-10(19)6-13(12)20)16(17-23-9-24-25-17)28-18(15)26-4-5-27-11(7-21)8-26/h2-3,6,9,11H,4-5,7-8H2,(H,23,24,25) |
| InChIKey | WRYPSHHLBCHETH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 58.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|