C18H14BrClN4OS — CID 59250016
5-[3-(4-bromo-2-chlorophenyl)-4-isocyano-5-(oxan-4-yl)thiophen-2-yl]-1H-1,2,4-triazole (PubChem CID 59250016) has the molecular formula C18H14BrClN4OS and a molecular weight of 449.76 g/mol. Its IUPAC name is 5-[3-(4-bromo-2-chlorophenyl)-4-isocyano-5-(oxan-4-yl)thiophen-2-yl]-1H-1,2,4-triazole.
| Compound Name | 5-[3-(4-bromo-2-chlorophenyl)-4-isocyano-5-(oxan-4-yl)thiophen-2-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 59250016 |
| Molecular Formula | C18H14BrClN4OS |
| Molecular Weight | 449.76 g/mol |
| Exact Mass | 447.98 |
| IUPAC Name | 5-[3-(4-bromo-2-chlorophenyl)-4-isocyano-5-(oxan-4-yl)thiophen-2-yl]-1H-1,2,4-triazole |
| SMILES | [C-]#[N+]c1c(C2CCOCC2)sc(-c2ncn[nH]2)c1-c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C18H14BrClN4OS/c1-21-15-14(12-3-2-11(19)8-13(12)20)17(18-22-9-23-24-18)26-16(15)10-4-6-25-7-5-10/h2-3,8-10H,4-7H2,(H,22,23,24) |
| InChIKey | CKZFPMRAZHSNEU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.76 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|