C23H36N4O3 — CID 59250205
morpholin-4-yl-[4-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]piperazin-1-yl]methanone (PubChem CID 59250205) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is morpholin-4-yl-[4-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]piperazin-1-yl]methanone.
| Compound Name | morpholin-4-yl-[4-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 59250205 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | morpholin-4-yl-[4-[4-(1-propan-2-ylpiperidin-4-yl)oxyphenyl]piperazin-1-yl]methanone |
| SMILES | CC(C)N1CCC(Oc2ccc(N3CCN(C(=O)N4CCOCC4)CC3)cc2)CC1 |
| InChI | InChI=1S/C23H36N4O3/c1-19(2)24-9-7-22(8-10-24)30-21-5-3-20(4-6-21)25-11-13-26(14-12-25)23(28)27-15-17-29-18-16-27/h3-6,19,22H,7-18H2,1-2H3 |
| InChIKey | WWPPLYXQFDJHHN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|