C15H17N3OS — CID 59250263
N-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]but-2-ynamide (PubChem CID 59250263) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is N-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]but-2-ynamide.
| Compound Name | N-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 59250263 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-[3-[(4S)-2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1cccc([C@]2(C)CCSC(N)=N2)c1 |
| InChI | InChI=1S/C15H17N3OS/c1-3-5-13(19)17-12-7-4-6-11(10-12)15(2)8-9-20-14(16)18-15/h4,6-7,10H,8-9H2,1-2H3,(H2,16,18)(H,17,19)/t15-/m0/s1 |
| InChIKey | UHIXWFSSYYDGOE-HNNXBMFYSA-N |
| XLogP | 2.32 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|