C14H18ClNO — CID 592503
2-(4-chlorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine (PubChem CID 592503) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | 2-(4-chlorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 592503 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-(4-chlorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine |
| SMILES | Clc1ccc(C2NCC3CCCCC3O2)cc1 |
| InChI | InChI=1S/C14H18ClNO/c15-12-7-5-10(6-8-12)14-16-9-11-3-1-2-4-13(11)17-14/h5-8,11,13-14,16H,1-4,9H2 |
| InChIKey | ZFOOKUKSLXPSFI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |