C10H7F3N4O2 — CID 59250515
methyl 5-[3-(trifluoromethyl)pyrazol-1-yl]pyrazine-2-carboxylate (PubChem CID 59250515) has the molecular formula C10H7F3N4O2 and a molecular weight of 272.19 g/mol. Its IUPAC name is methyl 5-[3-(trifluoromethyl)pyrazol-1-yl]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[3-(trifluoromethyl)pyrazol-1-yl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 59250515 |
| Molecular Formula | C10H7F3N4O2 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | methyl 5-[3-(trifluoromethyl)pyrazol-1-yl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(-n2ccc(C(F)(F)F)n2)cn1 |
| InChI | InChI=1S/C10H7F3N4O2/c1-19-9(18)6-4-15-8(5-14-6)17-3-2-7(16-17)10(11,12)13/h2-5H,1H3 |
| InChIKey | MHHDPPICZKVRMC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |