C25H23FN2O2 — CID 59251152
2-[[1-(4-fluorophenyl)indazol-5-yl]-phenylmethyl]pentanoic acid (PubChem CID 59251152) has the molecular formula C25H23FN2O2 and a molecular weight of 402.47 g/mol. Its IUPAC name is 2-[[1-(4-fluorophenyl)indazol-5-yl]-phenylmethyl]pentanoic acid.
| Compound Name | 2-[[1-(4-fluorophenyl)indazol-5-yl]-phenylmethyl]pentanoic acid |
|---|---|
| PubChem CID | 59251152 |
| Molecular Formula | C25H23FN2O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[[1-(4-fluorophenyl)indazol-5-yl]-phenylmethyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)C(c1ccccc1)c1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H23FN2O2/c1-2-6-22(25(29)30)24(17-7-4-3-5-8-17)18-9-14-23-19(15-18)16-27-28(23)21-12-10-20(26)11-13-21/h3-5,7-16,22,24H,2,6H2,1H3,(H,29,30) |
| InChIKey | VYUDXJSERNMCOR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |