C10H19N — CID 59251857
5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-amine (PubChem CID 59251857) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is 5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-amine.
| Compound Name | 5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 59251857 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-amine |
| SMILES | CC1CCC2CC(N)CC2C1 |
| InChI | InChI=1S/C10H19N/c1-7-2-3-8-5-10(11)6-9(8)4-7/h7-10H,2-6,11H2,1H3 |
| InChIKey | BUWYKHNXPUOHFP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |