About (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole
(2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole (PubChem CID 59252964) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole |
| PubChem CID | 59252964 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole |
| SMILES | CC(C)[C@@H]1CC=CN1 |
| InChI | InChI=1S/C7H13N/c1-6(2)7-4-3-5-8-7/h3,5-8H,4H2,1-2H3/t7-/m0/s1 |
| InChIKey | CDIULFWKTCDROR-ZETCQYMHSA-N |
| XLogP | 1.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole?
The IUPAC name of (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole (CID 59252964) is (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole?
The canonical SMILES for (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole is CC(C)[C@@H]1CC=CN1.
What is the InChIKey of (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole?
The InChIKey is CDIULFWKTCDROR-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H13N/c1-6(2)7-4-3-5-8-7/h3,5-8H,4H2,1-2H3/t7-/m0/s1.
What are the key properties of (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole?
(2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole has a molecular weight of 111.19 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-propan-2-yl-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 59252964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).