C18H30N2O4 — CID 59253208
N-[3-[1-(2-methoxyethoxymethyl)cyclohexyl]-1,2-oxazol-5-yl]-2,2-dimethylpropanamide (PubChem CID 59253208) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[3-[1-(2-methoxyethoxymethyl)cyclohexyl]-1,2-oxazol-5-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[1-(2-methoxyethoxymethyl)cyclohexyl]-1,2-oxazol-5-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 59253208 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-[3-[1-(2-methoxyethoxymethyl)cyclohexyl]-1,2-oxazol-5-yl]-2,2-dimethylpropanamide |
| SMILES | COCCOCC1(c2cc(NC(=O)C(C)(C)C)on2)CCCCC1 |
| InChI | InChI=1S/C18H30N2O4/c1-17(2,3)16(21)19-15-12-14(20-24-15)18(8-6-5-7-9-18)13-23-11-10-22-4/h12H,5-11,13H2,1-4H3,(H,19,21) |
| InChIKey | UIOJHBFBYUGPDX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|