C13H22N2O3 — CID 59253241
3-[(3S)-2-methyl-3-(oxan-2-yloxy)butan-2-yl]-1,2-oxazol-5-amine (PubChem CID 59253241) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-[(3S)-2-methyl-3-(oxan-2-yloxy)butan-2-yl]-1,2-oxazol-5-amine.
| Compound Name | 3-[(3S)-2-methyl-3-(oxan-2-yloxy)butan-2-yl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 59253241 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 3-[(3S)-2-methyl-3-(oxan-2-yloxy)butan-2-yl]-1,2-oxazol-5-amine |
| SMILES | C[C@H](OC1CCCCO1)C(C)(C)c1cc(N)on1 |
| InChI | InChI=1S/C13H22N2O3/c1-9(17-12-6-4-5-7-16-12)13(2,3)10-8-11(14)18-15-10/h8-9,12H,4-7,14H2,1-3H3/t9-,12?/m0/s1 |
| InChIKey | KQVLNNAPWIVDCN-QHGLUPRGSA-N |
| XLogP | 2.47 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |