About CID 59253499
CID 59253499 (PubChem CID 59253499) has the molecular formula C11H11O4W-
and a molecular weight of 391.05 g/mol.
Molecular Properties
| Compound Name | CID 59253499 |
| PubChem CID | 59253499 |
| Molecular Formula | C11H11O4W- |
| Molecular Weight | 391.05 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | — |
| SMILES | Cc1ccc(OC(=O)OCC2[CH-]O2)cc1.[W] |
| InChI | InChI=1S/C11H11O4.W/c1-8-2-4-9(5-3-8)15-11(12)14-7-10-6-13-10;/h2-6,10H,7H2,1H3;/q-1; |
| InChIKey | ZRPMFMGRSWHHPZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.05 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 59253499 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59253499?
The IUPAC name of CID 59253499 (CID 59253499) is not available.
What is the SMILES notation for CID 59253499?
The canonical SMILES for CID 59253499 is Cc1ccc(OC(=O)OCC2[CH-]O2)cc1.[W].
What is the InChIKey of CID 59253499?
The InChIKey is ZRPMFMGRSWHHPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11O4.W/c1-8-2-4-9(5-3-8)15-11(12)14-7-10-6-13-10;/h2-6,10H,7H2,1H3;/q-1;.
What are the key properties of CID 59253499?
CID 59253499 has a molecular weight of 391.05 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59253499 is sourced from PubChem (CID 59253499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).